C12H9BrN6O2 — CID 135507118
8-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,7-dihydropurin-6-one (PubChem CID 135507118) has the molecular formula C12H9BrN6O2 and a molecular weight of 349.15 g/mol. Its IUPAC name is 8-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,7-dihydropurin-6-one.
| Compound Name | 8-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135507118 |
| Molecular Formula | C12H9BrN6O2 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 8-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]cnc2nc(NN=Cc3cc(Br)ccc3O)[nH]c12 |
| InChI | InChI=1S/C12H9BrN6O2/c13-7-1-2-8(20)6(3-7)4-16-19-12-17-9-10(18-12)14-5-15-11(9)21/h1-5,20H,(H3,14,15,17,18,19,21) |
| InChIKey | YOOYBLXCWSUITM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|