C23H25N5O5 — CID 135507672
2-[[4-hydroxy-2-[[(2-hydroxyphenyl)methylideneamino]methyl]-5-(2-nitroimidazol-1-yl)pentyl]iminomethyl]phenol (PubChem CID 135507672) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[[4-hydroxy-2-[[(2-hydroxyphenyl)methylideneamino]methyl]-5-(2-nitroimidazol-1-yl)pentyl]iminomethyl]phenol.
| Compound Name | 2-[[4-hydroxy-2-[[(2-hydroxyphenyl)methylideneamino]methyl]-5-(2-nitroimidazol-1-yl)pentyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135507672 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[[4-hydroxy-2-[[(2-hydroxyphenyl)methylideneamino]methyl]-5-(2-nitroimidazol-1-yl)pentyl]iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1nccn1CC(O)CC(C/N=C/c1ccccc1O)C/N=C/c1ccccc1O |
| InChI | InChI=1S/C23H25N5O5/c29-20(16-27-10-9-26-23(27)28(32)33)11-17(12-24-14-18-5-1-3-7-21(18)30)13-25-15-19-6-2-4-8-22(19)31/h1-10,14-15,17,20,29-31H,11-13,16H2/b24-14+,25-15+ |
| InChIKey | CCSJKUHWXUEYPG-KOJZRSEWSA-N |
| XLogP | 2.81 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|