C21H39N7O6 — CID 10458080
4-[[[(3Z)-4-ethoxy-3-hydroxyimino-2-methylbutan-2-yl]amino]methyl]-5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-1-(2-nitroimidazol-1-yl)pentan-2-ol (PubChem CID 10458080) has the molecular formula C21H39N7O6 and a molecular weight of 485.59 g/mol. Its IUPAC name is 4-[[[(3Z)-4-ethoxy-3-hydroxyimino-2-methylbutan-2-yl]amino]methyl]-5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-1-(2-nitroimidazol-1-yl)pentan-2-ol.
| Compound Name | 4-[[[(3Z)-4-ethoxy-3-hydroxyimino-2-methylbutan-2-yl]amino]methyl]-5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-1-(2-nitroimidazol-1-yl)pentan-2-ol |
|---|---|
| PubChem CID | 10458080 |
| Molecular Formula | C21H39N7O6 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 4-[[[(3Z)-4-ethoxy-3-hydroxyimino-2-methylbutan-2-yl]amino]methyl]-5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-1-(2-nitroimidazol-1-yl)pentan-2-ol |
| SMILES | CCOC/C(=N\O)C(C)(C)NCC(CNC(C)(C)/C(C)=N\O)CC(O)Cn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H39N7O6/c1-7-34-14-18(26-31)21(5,6)24-12-16(11-23-20(3,4)15(2)25-30)10-17(29)13-27-9-8-22-19(27)28(32)33/h8-9,16-17,23-24,29-31H,7,10-14H2,1-6H3/b25-15-,26-18+ |
| InChIKey | WKLWALWTGNJVCA-VTRNKYNFSA-N |
| XLogP | 1.61 |
| TPSA | 179.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|