C20H32N10O6 — CID 151870580
N-[3-[4-[[3-hydroxyimino-2-methyl-4-(2-nitroimidazol-1-yl)butan-2-yl]amino]butylamino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine (PubChem CID 151870580) has the molecular formula C20H32N10O6 and a molecular weight of 508.54 g/mol. Its IUPAC name is N-[3-[4-[[3-hydroxyimino-2-methyl-4-(2-nitroimidazol-1-yl)butan-2-yl]amino]butylamino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | N-[3-[4-[[3-hydroxyimino-2-methyl-4-(2-nitroimidazol-1-yl)butan-2-yl]amino]butylamino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 151870580 |
| Molecular Formula | C20H32N10O6 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | N-[3-[4-[[3-hydroxyimino-2-methyl-4-(2-nitroimidazol-1-yl)butan-2-yl]amino]butylamino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CC(C)(NCCCCNC(C)(C)C(Cn1ccnc1[N+](=O)[O-])=NO)C(Cn1ccnc1[N+](=O)[O-])=NO |
| InChI | InChI=1S/C20H32N10O6/c1-19(2,15(25-31)13-27-11-9-21-17(27)29(33)34)23-7-5-6-8-24-20(3,4)16(26-32)14-28-12-10-22-18(28)30(35)36/h9-12,23-24,31-32H,5-8,13-14H2,1-4H3 |
| InChIKey | SMPFWDSPRJMECL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|