C17H31N7O4 — CID 85134794
N-[2-[3-[(3-hydroxyimino-2-methylbutan-2-yl)amino]propylamino]-2-methyl-5-(2-nitro-1H-imidazol-5-yl)pentan-3-ylidene]hydroxylamine (PubChem CID 85134794) has the molecular formula C17H31N7O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[2-[3-[(3-hydroxyimino-2-methylbutan-2-yl)amino]propylamino]-2-methyl-5-(2-nitro-1H-imidazol-5-yl)pentan-3-ylidene]hydroxylamine.
| Compound Name | N-[2-[3-[(3-hydroxyimino-2-methylbutan-2-yl)amino]propylamino]-2-methyl-5-(2-nitro-1H-imidazol-5-yl)pentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 85134794 |
| Molecular Formula | C17H31N7O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[2-[3-[(3-hydroxyimino-2-methylbutan-2-yl)amino]propylamino]-2-methyl-5-(2-nitro-1H-imidazol-5-yl)pentan-3-ylidene]hydroxylamine |
| SMILES | CC(=NO)C(C)(C)NCCCNC(C)(C)C(CCc1cnc([N+](=O)[O-])[nH]1)=NO |
| InChI | InChI=1S/C17H31N7O4/c1-12(22-25)16(2,3)19-9-6-10-20-17(4,5)14(23-26)8-7-13-11-18-15(21-13)24(27)28/h11,19-20,25-26H,6-10H2,1-5H3,(H,18,21) |
| InChIKey | JADHSIJCNJRYRK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|