C10H17N3O4 — CID 139710416
1-[(2-methylpropan-2-yl)oxy]-3-(2-nitro-1H-imidazol-5-yl)propan-2-ol (PubChem CID 139710416) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]-3-(2-nitro-1H-imidazol-5-yl)propan-2-ol.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]-3-(2-nitro-1H-imidazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 139710416 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]-3-(2-nitro-1H-imidazol-5-yl)propan-2-ol |
| SMILES | CC(C)(C)OCC(O)Cc1cnc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C10H17N3O4/c1-10(2,3)17-6-8(14)4-7-5-11-9(12-7)13(15)16/h5,8,14H,4,6H2,1-3H3,(H,11,12) |
| InChIKey | MOZIFFIDRJRGEU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|