C16H29N7O5 — CID 87813131
N-[2-[2-[(3-hydroxyimino-2-methylbutan-2-yl)amino]ethoxyamino]-2-methyl-5-(2-nitroimidazol-1-yl)pentan-3-ylidene]hydroxylamine (PubChem CID 87813131) has the molecular formula C16H29N7O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[2-[2-[(3-hydroxyimino-2-methylbutan-2-yl)amino]ethoxyamino]-2-methyl-5-(2-nitroimidazol-1-yl)pentan-3-ylidene]hydroxylamine.
| Compound Name | N-[2-[2-[(3-hydroxyimino-2-methylbutan-2-yl)amino]ethoxyamino]-2-methyl-5-(2-nitroimidazol-1-yl)pentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87813131 |
| Molecular Formula | C16H29N7O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[2-[2-[(3-hydroxyimino-2-methylbutan-2-yl)amino]ethoxyamino]-2-methyl-5-(2-nitroimidazol-1-yl)pentan-3-ylidene]hydroxylamine |
| SMILES | CC(=NO)C(C)(C)NCCONC(C)(C)C(CCn1ccnc1[N+](=O)[O-])=NO |
| InChI | InChI=1S/C16H29N7O5/c1-12(19-24)15(2,3)18-8-11-28-21-16(4,5)13(20-25)6-9-22-10-7-17-14(22)23(26)27/h7,10,18,21,24-25H,6,8-9,11H2,1-5H3 |
| InChIKey | IEBHQHMVFATGRR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|