C16H25N5O6 — CID 22073764
3-methyl-3-[2-[[2-methyl-5-(2-nitroimidazol-1-yl)-3-oxopentan-2-yl]amino]ethoxyamino]-2-oxobutanal (PubChem CID 22073764) has the molecular formula C16H25N5O6 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-methyl-3-[2-[[2-methyl-5-(2-nitroimidazol-1-yl)-3-oxopentan-2-yl]amino]ethoxyamino]-2-oxobutanal.
| Compound Name | 3-methyl-3-[2-[[2-methyl-5-(2-nitroimidazol-1-yl)-3-oxopentan-2-yl]amino]ethoxyamino]-2-oxobutanal |
|---|---|
| PubChem CID | 22073764 |
| Molecular Formula | C16H25N5O6 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3-methyl-3-[2-[[2-methyl-5-(2-nitroimidazol-1-yl)-3-oxopentan-2-yl]amino]ethoxyamino]-2-oxobutanal |
| SMILES | CC(C)(NOCCNC(C)(C)C(=O)CCn1ccnc1[N+](=O)[O-])C(=O)C=O |
| InChI | InChI=1S/C16H25N5O6/c1-15(2,18-7-10-27-19-16(3,4)13(24)11-22)12(23)5-8-20-9-6-17-14(20)21(25)26/h6,9,11,18-19H,5,7-8,10H2,1-4H3 |
| InChIKey | ILLZERKFXBGALN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|