C19H33N5O4 — CID 174320334
2-[[2-ethyl-2-[[[2-methyl-4-(2-nitroimidazol-1-yl)-3-oxobutan-2-yl]amino]methyl]butyl]amino]-2-methylpropanal (PubChem CID 174320334) has the molecular formula C19H33N5O4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[[2-ethyl-2-[[[2-methyl-4-(2-nitroimidazol-1-yl)-3-oxobutan-2-yl]amino]methyl]butyl]amino]-2-methylpropanal.
| Compound Name | 2-[[2-ethyl-2-[[[2-methyl-4-(2-nitroimidazol-1-yl)-3-oxobutan-2-yl]amino]methyl]butyl]amino]-2-methylpropanal |
|---|---|
| PubChem CID | 174320334 |
| Molecular Formula | C19H33N5O4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 2-[[2-ethyl-2-[[[2-methyl-4-(2-nitroimidazol-1-yl)-3-oxobutan-2-yl]amino]methyl]butyl]amino]-2-methylpropanal |
| SMILES | CCC(CC)(CNC(C)(C)C=O)CNC(C)(C)C(=O)Cn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H33N5O4/c1-7-19(8-2,12-21-17(3,4)14-25)13-22-18(5,6)15(26)11-23-10-9-20-16(23)24(27)28/h9-10,14,21-22H,7-8,11-13H2,1-6H3 |
| InChIKey | WMACBSWPNUYPQW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|