C20H37N7O4 — CID 85141610
N-[3-[[2-ethyl-2-[[(3-hydroxyimino-2-methylbutan-2-yl)amino]methyl]butyl]amino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine (PubChem CID 85141610) has the molecular formula C20H37N7O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[3-[[2-ethyl-2-[[(3-hydroxyimino-2-methylbutan-2-yl)amino]methyl]butyl]amino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | N-[3-[[2-ethyl-2-[[(3-hydroxyimino-2-methylbutan-2-yl)amino]methyl]butyl]amino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 85141610 |
| Molecular Formula | C20H37N7O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-[3-[[2-ethyl-2-[[(3-hydroxyimino-2-methylbutan-2-yl)amino]methyl]butyl]amino]-3-methyl-1-(2-nitroimidazol-1-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CCC(CC)(CNC(C)(C)C(C)=NO)CNC(C)(C)C(Cn1ccnc1[N+](=O)[O-])=NO |
| InChI | InChI=1S/C20H37N7O4/c1-8-20(9-2,13-22-18(4,5)15(3)24-28)14-23-19(6,7)16(25-29)12-26-11-10-21-17(26)27(30)31/h10-11,22-23,28-29H,8-9,12-14H2,1-7H3 |
| InChIKey | QHEUHNFTPBEWAN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|