C17H31N7O4 — CID 54198381
N'-[2-methyl-5-(2-nitroimidazol-1-yl)-3-nitrosopentan-2-yl]-N-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine (PubChem CID 54198381) has the molecular formula C17H31N7O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N'-[2-methyl-5-(2-nitroimidazol-1-yl)-3-nitrosopentan-2-yl]-N-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine.
| Compound Name | N'-[2-methyl-5-(2-nitroimidazol-1-yl)-3-nitrosopentan-2-yl]-N-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54198381 |
| Molecular Formula | C17H31N7O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N'-[2-methyl-5-(2-nitroimidazol-1-yl)-3-nitrosopentan-2-yl]-N-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine |
| SMILES | CC(N=O)C(C)(C)NCCCNC(C)(C)C(CCn1ccnc1[N+](=O)[O-])N=O |
| InChI | InChI=1S/C17H31N7O4/c1-13(21-25)16(2,3)19-8-6-9-20-17(4,5)14(22-26)7-11-23-12-10-18-15(23)24(27)28/h10,12-14,19-20H,6-9,11H2,1-5H3 |
| InChIKey | PNLUJLDXLCKENZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|