C10H11N4O2+ — CID 135508718
9-[(1S,4R)-4-(hydroxymethyl)cyclobut-2-en-1-yl]-1,7-dihydropurin-9-ium-6-one (PubChem CID 135508718) has the molecular formula C10H11N4O2+ and a molecular weight of 219.22 g/mol. Its IUPAC name is 9-[(1S,4R)-4-(hydroxymethyl)cyclobut-2-en-1-yl]-1,7-dihydropurin-9-ium-6-one.
| Compound Name | 9-[(1S,4R)-4-(hydroxymethyl)cyclobut-2-en-1-yl]-1,7-dihydropurin-9-ium-6-one |
|---|---|
| PubChem CID | 135508718 |
| Molecular Formula | C10H11N4O2+ |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 9-[(1S,4R)-4-(hydroxymethyl)cyclobut-2-en-1-yl]-1,7-dihydropurin-9-ium-6-one |
| SMILES | O=c1[nH]cnc2c1[nH]c[n+]2[C@H]1C=C[C@H]1CO |
| InChI | InChI=1S/C10H10N4O2/c15-3-6-1-2-7(6)14-5-13-8-9(14)11-4-12-10(8)16/h1-2,4-7,15H,3H2,(H,11,12,16)/p+1/t6-,7-/m0/s1 |
| InChIKey | PPOKWATUTNBWPR-BQBZGAKWSA-O |
| XLogP | -0.74 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|