C38H38N4O6 — CID 135516569
[(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-[4-methoxy-N-[2-(4-nitrophenyl)ethyl]anilino]-3-oxopropanoate (PubChem CID 135516569) has the molecular formula C38H38N4O6 and a molecular weight of 646.74 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-[4-methoxy-N-[2-(4-nitrophenyl)ethyl]anilino]-3-oxopropanoate.
| Compound Name | [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-[4-methoxy-N-[2-(4-nitrophenyl)ethyl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 135516569 |
| Molecular Formula | C38H38N4O6 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-[4-methoxy-N-[2-(4-nitrophenyl)ethyl]anilino]-3-oxopropanoate |
| SMILES | COc1ccc(N(CCc2ccc([N+](=O)[O-])cc2)C(=O)C(=[N+]=[N-])C(=O)O[C@H]2[C@@H]3CC[C@](C)([C@H]2c2cccc4ccccc24)C3(C)C)cc1 |
| InChI | InChI=1S/C38H38N4O6/c1-37(2)31-20-22-38(37,3)32(30-11-7-9-25-8-5-6-10-29(25)30)34(31)48-36(44)33(40-39)35(43)41(26-16-18-28(47-4)19-17-26)23-21-24-12-14-27(15-13-24)42(45)46/h5-19,31-32,34H,20-23H2,1-4H3/t31-,32-,34-,38+/m0/s1 |
| InChIKey | VXNUJXVJJFGJRA-SHHZUYMNSA-N |
| XLogP | 7.15 |
| TPSA | 135.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|