C38H37N2O6- — CID 57363404
(3S,4R)-1-(4-methoxyphenyl)-4-(4-nitrophenyl)-2-oxo-3-[(1R,2S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl]pyrrolidine-3-carboxylate (PubChem CID 57363404) has the molecular formula C38H37N2O6- and a molecular weight of 617.72 g/mol. Its IUPAC name is (3S,4R)-1-(4-methoxyphenyl)-4-(4-nitrophenyl)-2-oxo-3-[(1R,2S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl]pyrrolidine-3-carboxylate.
| Compound Name | (3S,4R)-1-(4-methoxyphenyl)-4-(4-nitrophenyl)-2-oxo-3-[(1R,2S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 57363404 |
| Molecular Formula | C38H37N2O6- |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | (3S,4R)-1-(4-methoxyphenyl)-4-(4-nitrophenyl)-2-oxo-3-[(1R,2S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl]pyrrolidine-3-carboxylate |
| SMILES | COc1ccc(N2C[C@H](c3ccc([N+](=O)[O-])cc3)[C@@](C(=O)[O-])([C@@H]3C(c4cccc5ccccc45)[C@@]4(C)CC[C@H]3C4(C)C)C2=O)cc1 |
| InChI | InChI=1S/C38H38N2O6/c1-36(2)30-20-21-37(36,3)32(29-11-7-9-23-8-5-6-10-28(23)29)33(30)38(35(42)43)31(24-12-14-26(15-13-24)40(44)45)22-39(34(38)41)25-16-18-27(46-4)19-17-25/h5-19,30-33H,20-22H2,1-4H3,(H,42,43)/p-1/t30-,31-,32?,33+,37-,38-/m1/s1 |
| InChIKey | FVHWBBXDBAUCST-NFSLPHGSSA-M |
| XLogP | 6.48 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|