C20H19NO4 — CID 135526266
2-[[1-(2-hydroxy-6-oxocyclohexen-1-yl)-2-naphthalen-1-ylethylidene]amino]acetic acid (PubChem CID 135526266) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[[1-(2-hydroxy-6-oxocyclohexen-1-yl)-2-naphthalen-1-ylethylidene]amino]acetic acid.
| Compound Name | 2-[[1-(2-hydroxy-6-oxocyclohexen-1-yl)-2-naphthalen-1-ylethylidene]amino]acetic acid |
|---|---|
| PubChem CID | 135526266 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[[1-(2-hydroxy-6-oxocyclohexen-1-yl)-2-naphthalen-1-ylethylidene]amino]acetic acid |
| SMILES | O=C(O)C/N=C(/Cc1cccc2ccccc12)C1=C(O)CCCC1=O |
| InChI | InChI=1S/C20H19NO4/c22-17-9-4-10-18(23)20(17)16(21-12-19(24)25)11-14-7-3-6-13-5-1-2-8-15(13)14/h1-3,5-8,22H,4,9-12H2,(H,24,25)/b21-16- |
| InChIKey | VRAPLYPXSOOCTI-PGMHBOJBSA-N |
| XLogP | 3.47 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|