C26H30FN5O2S — CID 135533930
N-(2,6-dimethylphenyl)-2-[2-[1-(3-fluoro-4-piperidin-1-ylphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135533930) has the molecular formula C26H30FN5O2S and a molecular weight of 495.62 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[2-[1-(3-fluoro-4-piperidin-1-ylphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[2-[1-(3-fluoro-4-piperidin-1-ylphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135533930 |
| Molecular Formula | C26H30FN5O2S |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[2-[1-(3-fluoro-4-piperidin-1-ylphenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=NN=C1NC(=O)C(CC(=O)Nc2c(C)cccc2C)S1)c1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C26H30FN5O2S/c1-16-8-7-9-17(2)24(16)28-23(33)15-22-25(34)29-26(35-22)31-30-18(3)19-10-11-21(20(27)14-19)32-12-5-4-6-13-32/h7-11,14,22H,4-6,12-13,15H2,1-3H3,(H,28,33)(H,29,31,34) |
| InChIKey | FDRLELVTIZDQEV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|