C14H13N5O2S — CID 135541315
2-[(7-methyl-6-oxo-1H-purin-2-yl)sulfanyl]-N-phenylacetamide (PubChem CID 135541315) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-[(7-methyl-6-oxo-1H-purin-2-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[(7-methyl-6-oxo-1H-purin-2-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135541315 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[(7-methyl-6-oxo-1H-purin-2-yl)sulfanyl]-N-phenylacetamide |
| SMILES | Cn1cnc2nc(SCC(=O)Nc3ccccc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H13N5O2S/c1-19-8-15-12-11(19)13(21)18-14(17-12)22-7-10(20)16-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,16,20)(H,17,18,21) |
| InChIKey | CUJIXDDGYZWGTO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |