C44H23N4O8Si7 — CID 135548066
CID 135548066 (PubChem CID 135548066) has the molecular formula C44H23N4O8Si7 and a molecular weight of 932.29 g/mol.
| Compound Name | CID 135548066 |
|---|---|
| PubChem CID | 135548066 |
| Molecular Formula | C44H23N4O8Si7 |
| Molecular Weight | 932.29 g/mol |
| Exact Mass | 930.99 |
| IUPAC Name | — |
| SMILES | Oc1cccc(O[Si])c1-c1c2nc(c(-c3c(O[Si])cccc3O[Si])c3ccc([nH]3)c(-c3c(O[Si])cccc3O[Si])c3nc(c(-c4c(O[Si])cccc4O[Si])c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C44H23N4O8Si7/c49-29-5-1-6-30(50-57)41(29)37-21-13-15-23(45-21)38(42-31(51-58)7-2-8-32(42)52-59)25-17-19-27(47-25)40(44-35(55-62)11-4-12-36(44)56-63)28-20-18-26(48-28)39(24-16-14-22(37)46-24)43-33(53-60)9-3-10-34(43)54-61/h1-20,45,48-49H/b37-21+,37-22+,38-23+,38-25+,39-24+,39-26+,40-27+,40-28+ |
| InChIKey | BGCBBHPPZHKHKY-GZNZDWAPSA-N |
| XLogP | 7.27 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.29 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|