C19H20FN3O3S2 — CID 135550921
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-fluorophenyl)methyl]-4-methylsulfanylbutanamide (PubChem CID 135550921) has the molecular formula C19H20FN3O3S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-fluorophenyl)methyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-fluorophenyl)methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 135550921 |
| Molecular Formula | C19H20FN3O3S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-fluorophenyl)methyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C19H20FN3O3S2/c1-27-11-10-16(19(24)21-12-13-6-2-4-8-15(13)20)22-18-14-7-3-5-9-17(14)28(25,26)23-18/h2-9,16H,10-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | ZUQGRQSDQPYFCK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|