C19H27N3O3S — CID 135583660
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-(4-methylpiperidin-1-yl)pentan-1-one (PubChem CID 135583660) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-(4-methylpiperidin-1-yl)pentan-1-one.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-(4-methylpiperidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 135583660 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-(4-methylpiperidin-1-yl)pentan-1-one |
| SMILES | CCC(C)C(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C19H27N3O3S/c1-4-14(3)17(19(23)22-11-9-13(2)10-12-22)20-18-15-7-5-6-8-16(15)26(24,25)21-18/h5-8,13-14,17H,4,9-12H2,1-3H3,(H,20,21) |
| InChIKey | GZWQWRGAQSETGZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|