C8H12BNO — CID 135556134
2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine (PubChem CID 135556134) has the molecular formula C8H12BNO and a molecular weight of 149.00 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine.
| Compound Name | 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 135556134 |
| Molecular Formula | C8H12BNO |
| Molecular Weight | 149.00 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-yl-4-methyl-1,3,2-oxazaborolidine |
| SMILES | CC1COB(C2=CCC=C2)N1 |
| InChI | InChI=1S/C8H12BNO/c1-7-6-11-9(10-7)8-4-2-3-5-8/h2,4-5,7,10H,3,6H2,1H3 |
| InChIKey | VTUBYWRCZSYVDR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.00 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|