C22H22N2O6 — CID 135557750
methyl (E)-2-(1H-benzimidazol-2-yl)-4-[2-(4-ethoxyphenyl)acetyl]oxy-3-hydroxybut-2-enoate (PubChem CID 135557750) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl (E)-2-(1H-benzimidazol-2-yl)-4-[2-(4-ethoxyphenyl)acetyl]oxy-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[2-(4-ethoxyphenyl)acetyl]oxy-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135557750 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | methyl (E)-2-(1H-benzimidazol-2-yl)-4-[2-(4-ethoxyphenyl)acetyl]oxy-3-hydroxybut-2-enoate |
| SMILES | CCOc1ccc(CC(=O)OC/C(O)=C(\C(=O)OC)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-3-29-15-10-8-14(9-11-15)12-19(26)30-13-18(25)20(22(27)28-2)21-23-16-6-4-5-7-17(16)24-21/h4-11,25H,3,12-13H2,1-2H3,(H,23,24)/b20-18+ |
| InChIKey | RNTHUGSVVVDUPY-CZIZESTLSA-N |
| XLogP | 3.19 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|