C23H24N2O5 — CID 135620268
[(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 4-butylbenzoate (PubChem CID 135620268) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 4-butylbenzoate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 4-butylbenzoate |
|---|---|
| PubChem CID | 135620268 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC/C(O)=C(\C(=O)OC)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H24N2O5/c1-3-4-7-15-10-12-16(13-11-15)22(27)30-14-19(26)20(23(28)29-2)21-24-17-8-5-6-9-18(17)25-21/h5-6,8-13,26H,3-4,7,14H2,1-2H3,(H,24,25)/b20-19+ |
| InChIKey | SPDSFPJPNJWEBI-FMQUCBEESA-N |
| XLogP | 4.20 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|