C22H18N2O5S — CID 135620370
[(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 135620370) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 135620370 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-2-hydroxy-4-methoxy-4-oxobut-2-enyl] 3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)/C(=C(/O)COC(=O)c1sc2ccccc2c1C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H18N2O5S/c1-12-13-7-3-6-10-17(13)30-19(12)22(27)29-11-16(25)18(21(26)28-2)20-23-14-8-4-5-9-15(14)24-20/h3-10,25H,11H2,1-2H3,(H,23,24)/b18-16+ |
| InChIKey | JHXOVYWRXDRVOS-FBMGVBCBSA-N |
| XLogP | 4.39 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|