C18H21N4O2S+ — CID 135574860
15-methyl-8-morpholin-4-yl-11-thia-14,16-diaza-9-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),15-pentaen-13-one (PubChem CID 135574860) has the molecular formula C18H21N4O2S+ and a molecular weight of 357.46 g/mol. Its IUPAC name is 15-methyl-8-morpholin-4-yl-11-thia-14,16-diaza-9-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),15-pentaen-13-one.
| Compound Name | 15-methyl-8-morpholin-4-yl-11-thia-14,16-diaza-9-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),15-pentaen-13-one |
|---|---|
| PubChem CID | 135574860 |
| Molecular Formula | C18H21N4O2S+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 15-methyl-8-morpholin-4-yl-11-thia-14,16-diaza-9-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),15-pentaen-13-one |
| SMILES | Cc1nc2c(sc3[nH+]c(N4CCOCC4)c4c(c32)CCCC4)c(=O)[nH]1 |
| InChI | InChI=1S/C18H20N4O2S/c1-10-19-14-13-11-4-2-3-5-12(11)16(22-6-8-24-9-7-22)21-18(13)25-15(14)17(23)20-10/h2-9H2,1H3,(H,19,20,23)/p+1 |
| InChIKey | BTENNEYZZLSSNE-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |