C23H28ClN3O4 — CID 135583861
2-O-butyl 5-O-ethyl 4-(2-chlorophenyl)-6-propyl-4,7-dihydropyrazolo[3,4-b]pyridine-2,5-dicarboxylate (PubChem CID 135583861) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is 2-O-butyl 5-O-ethyl 4-(2-chlorophenyl)-6-propyl-4,7-dihydropyrazolo[3,4-b]pyridine-2,5-dicarboxylate.
| Compound Name | 2-O-butyl 5-O-ethyl 4-(2-chlorophenyl)-6-propyl-4,7-dihydropyrazolo[3,4-b]pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 135583861 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-O-butyl 5-O-ethyl 4-(2-chlorophenyl)-6-propyl-4,7-dihydropyrazolo[3,4-b]pyridine-2,5-dicarboxylate |
| SMILES | CCCCOC(=O)n1cc2c(n1)NC(CCC)=C(C(=O)OCC)C2c1ccccc1Cl |
| InChI | InChI=1S/C23H28ClN3O4/c1-4-7-13-31-23(29)27-14-16-19(15-11-8-9-12-17(15)24)20(22(28)30-6-3)18(10-5-2)25-21(16)26-27/h8-9,11-12,14,19H,4-7,10,13H2,1-3H3,(H,25,26) |
| InChIKey | DJMVYGHYXLZXHX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|