C36H40N2O4 — CID 135589320
2-[(E)-N-[(E)-[(2-hydroxy-5-pentoxyphenyl)-phenylmethylidene]amino]-C-phenylcarbonimidoyl]-4-pentoxyphenol (PubChem CID 135589320) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[(E)-N-[(E)-[(2-hydroxy-5-pentoxyphenyl)-phenylmethylidene]amino]-C-phenylcarbonimidoyl]-4-pentoxyphenol.
| Compound Name | 2-[(E)-N-[(E)-[(2-hydroxy-5-pentoxyphenyl)-phenylmethylidene]amino]-C-phenylcarbonimidoyl]-4-pentoxyphenol |
|---|---|
| PubChem CID | 135589320 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2-[(E)-N-[(E)-[(2-hydroxy-5-pentoxyphenyl)-phenylmethylidene]amino]-C-phenylcarbonimidoyl]-4-pentoxyphenol |
| SMILES | CCCCCOc1ccc(O)c(/C(=N/N=C(\c2ccccc2)c2cc(OCCCCC)ccc2O)c2ccccc2)c1 |
| InChI | InChI=1S/C36H40N2O4/c1-3-5-13-23-41-29-19-21-33(39)31(25-29)35(27-15-9-7-10-16-27)37-38-36(28-17-11-8-12-18-28)32-26-30(20-22-34(32)40)42-24-14-6-4-2/h7-12,15-22,25-26,39-40H,3-6,13-14,23-24H2,1-2H3/b37-35+,38-36+ |
| InChIKey | ZCYNQTBZBGAODO-ATXIYDNESA-N |
| XLogP | 8.53 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|