C24H19N5O2S — CID 135591186
2-(2,4-dimethylphenyl)-3-hydroxy-4-[(E)-(thieno[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]isoquinolin-1-one (PubChem CID 135591186) has the molecular formula C24H19N5O2S and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-3-hydroxy-4-[(E)-(thieno[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]isoquinolin-1-one.
| Compound Name | 2-(2,4-dimethylphenyl)-3-hydroxy-4-[(E)-(thieno[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 135591186 |
| Molecular Formula | C24H19N5O2S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-3-hydroxy-4-[(E)-(thieno[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]isoquinolin-1-one |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/Nc3ncnc4sccc34)c3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C24H19N5O2S/c1-14-7-8-20(15(2)11-14)29-23(30)17-6-4-3-5-16(17)19(24(29)31)12-27-28-21-18-9-10-32-22(18)26-13-25-21/h3-13,31H,1-2H3,(H,25,26,28)/b27-12+ |
| InChIKey | SRBWPHBARNYPAW-KKMKTNMSSA-N |
| XLogP | 4.76 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|