C18H17NO3 — CID 135598162
2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yliminomethyl)phenol (PubChem CID 135598162) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yliminomethyl)phenol.
| Compound Name | 2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yliminomethyl)phenol |
|---|---|
| PubChem CID | 135598162 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yliminomethyl)phenol |
| SMILES | Oc1ccccc1/C=N/c1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C18H17NO3/c20-15-6-2-1-5-13(15)12-19-14-7-8-16-17(11-14)22-18(21-16)9-3-4-10-18/h1-2,5-8,11-12,20H,3-4,9-10H2/b19-12+ |
| InChIKey | BATGNOWSBOYFEN-XDHOZWIPSA-N |
| XLogP | 4.18 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|