C19H22N3O2+ — CID 135625513
4-[(E)-(1-ethyl-6-methoxyquinolin-2-ylidene)methyl]-1,3-dimethylpyrimidin-1-ium-2-one (PubChem CID 135625513) has the molecular formula C19H22N3O2+ and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-[(E)-(1-ethyl-6-methoxyquinolin-2-ylidene)methyl]-1,3-dimethylpyrimidin-1-ium-2-one.
| Compound Name | 4-[(E)-(1-ethyl-6-methoxyquinolin-2-ylidene)methyl]-1,3-dimethylpyrimidin-1-ium-2-one |
|---|---|
| PubChem CID | 135625513 |
| Molecular Formula | C19H22N3O2+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[(E)-(1-ethyl-6-methoxyquinolin-2-ylidene)methyl]-1,3-dimethylpyrimidin-1-ium-2-one |
| SMILES | CCN1/C(=C/c2cc[n+](C)c(=O)n2C)C=Cc2cc(OC)ccc21 |
| InChI | InChI=1S/C19H22N3O2/c1-5-22-16(13-15-10-11-20(2)19(23)21(15)3)7-6-14-12-17(24-4)8-9-18(14)22/h6-13H,5H2,1-4H3/q+1 |
| InChIKey | NWMSAOVHWBNWOO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|