C21H33N3O5 — CID 135638870
2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide (PubChem CID 135638870) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 135638870 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2-[4-(3-hydroxy-6-methyl-4-oxopyran-2-yl)oxan-4-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
| SMILES | Cc1cc(=O)c(O)c(C2(CC(=O)NCCCN3CCN(C)CC3)CCOCC2)o1 |
| InChI | InChI=1S/C21H33N3O5/c1-16-14-17(25)19(27)20(29-16)21(4-12-28-13-5-21)15-18(26)22-6-3-7-24-10-8-23(2)9-11-24/h14,27H,3-13,15H2,1-2H3,(H,22,26) |
| InChIKey | IMTYLWONEURTCT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|