C28H24N4O5 — CID 135639651
N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinolin-6-ylpropanamide (PubChem CID 135639651) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinolin-6-ylpropanamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 135639651 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinolin-6-ylpropanamide |
| SMILES | O=C(CC(c1ccc2ncccc2c1)c1c(O)nc2ccccn2c1=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H24N4O5/c33-22-9-6-17(14-23(22)34)10-12-30-25(35)16-20(18-7-8-21-19(15-18)4-3-11-29-21)26-27(36)31-24-5-1-2-13-32(24)28(26)37/h1-9,11,13-15,20,33-34,36H,10,12,16H2,(H,30,35) |
| InChIKey | PLRAXRBRZCYMKK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|