C23H21N3O5S — CID 136849630
(3R)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-thiophen-3-ylpropanamide (PubChem CID 136849630) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is (3R)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-thiophen-3-ylpropanamide.
| Compound Name | (3R)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 136849630 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (3R)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-thiophen-3-ylpropanamide |
| SMILES | O=C(C[C@@H](c1ccsc1)c1c(O)nc2ccccn2c1=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H21N3O5S/c27-17-5-4-14(11-18(17)28)6-8-24-20(29)12-16(15-7-10-32-13-15)21-22(30)25-19-3-1-2-9-26(19)23(21)31/h1-5,7,9-11,13,16,27-28,30H,6,8,12H2,(H,24,29)/t16-/m0/s1 |
| InChIKey | CROCKSWSSGZSOW-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|