C25H22ClN3O5 — CID 136699420
(3R)-3-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)propanamide (PubChem CID 136699420) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)propanamide.
| Compound Name | (3R)-3-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 136699420 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)propanamide |
| SMILES | O=C(C[C@H](c1ccc(Cl)cc1)c1c(O)nc2ccccn2c1=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H22ClN3O5/c26-17-7-5-16(6-8-17)18(23-24(33)28-21-3-1-2-12-29(21)25(23)34)14-22(32)27-11-10-15-4-9-19(30)20(31)13-15/h1-9,12-13,18,30-31,33H,10-11,14H2,(H,27,32)/t18-/m1/s1 |
| InChIKey | OLGALTVWARGNHX-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|