C27H23N5O5 — CID 136902537
(3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinoxalin-6-ylpropanamide (PubChem CID 136902537) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is (3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinoxalin-6-ylpropanamide.
| Compound Name | (3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinoxalin-6-ylpropanamide |
|---|---|
| PubChem CID | 136902537 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-quinoxalin-6-ylpropanamide |
| SMILES | O=C(C[C@@H](c1ccc2nccnc2c1)c1c(O)nc2ccccn2c1=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H23N5O5/c33-21-7-4-16(13-22(21)34)8-9-30-24(35)15-18(17-5-6-19-20(14-17)29-11-10-28-19)25-26(36)31-23-3-1-2-12-32(23)27(25)37/h1-7,10-14,18,33-34,36H,8-9,15H2,(H,30,35)/t18-/m0/s1 |
| InChIKey | OTTDJKIVHNSACF-SFHVURJKSA-N |
| XLogP | 2.64 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|