C27H25N3O8 — CID 136678713
(3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)propanamide (PubChem CID 136678713) has the molecular formula C27H25N3O8 and a molecular weight of 519.51 g/mol. Its IUPAC name is (3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)propanamide.
| Compound Name | (3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 136678713 |
| Molecular Formula | C27H25N3O8 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (3S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(7-methoxy-1,3-benzodioxol-5-yl)propanamide |
| SMILES | COc1cc([C@H](CC(=O)NCCc2ccc(O)c(O)c2)c2c(O)nc3ccccn3c2=O)cc2c1OCO2 |
| InChI | InChI=1S/C27H25N3O8/c1-36-20-11-16(12-21-25(20)38-14-37-21)17(24-26(34)29-22-4-2-3-9-30(22)27(24)35)13-23(33)28-8-7-15-5-6-18(31)19(32)10-15/h2-6,9-12,17,31-32,34H,7-8,13-14H2,1H3,(H,28,33)/t17-/m0/s1 |
| InChIKey | NTORLFLOVJGSGI-KRWDZBQOSA-N |
| XLogP | 2.43 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|