C18H12ClN5O — CID 135644849
[4-[(E)-2-(2-chlorophenyl)ethenyl]-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]cyanamide (PubChem CID 135644849) has the molecular formula C18H12ClN5O and a molecular weight of 349.78 g/mol. Its IUPAC name is [4-[(E)-2-(2-chlorophenyl)ethenyl]-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]cyanamide.
| Compound Name | [4-[(E)-2-(2-chlorophenyl)ethenyl]-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]cyanamide |
|---|---|
| PubChem CID | 135644849 |
| Molecular Formula | C18H12ClN5O |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [4-[(E)-2-(2-chlorophenyl)ethenyl]-6-(2-hydroxyphenyl)-1,3,5-triazin-2-yl]cyanamide |
| SMILES | N#CNc1nc(/C=C/c2ccccc2Cl)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C18H12ClN5O/c19-14-7-3-1-5-12(14)9-10-16-22-17(24-18(23-16)21-11-20)13-6-2-4-8-15(13)25/h1-10,25H,(H,21,22,23,24)/b10-9+ |
| InChIKey | ITUORZHZJJGBES-MDZDMXLPSA-N |
| XLogP | 3.96 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|