C21H16ClN5O4 — CID 135653560
1-(4-chlorophenyl)-6-hydroxy-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyliminomethyl]pyrimidine-2,4-dione (PubChem CID 135653560) has the molecular formula C21H16ClN5O4 and a molecular weight of 437.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135653560 |
| Molecular Formula | C21H16ClN5O4 |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyliminomethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(Cl)cc2)c(O)c1/C=N/CCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C21H16ClN5O4/c22-14-6-8-15(9-7-14)27-20(29)16(19(28)25-21(27)30)12-23-11-10-17-24-18(26-31-17)13-4-2-1-3-5-13/h1-9,12,29H,10-11H2,(H,25,28,30)/b23-12+ |
| InChIKey | LPSQLQMMXPVPOO-FSJBWODESA-N |
| XLogP | 2.60 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|