C49H38N4O — CID 135665874
(Z)-[5,10,15,20-tetrakis(4-methylphenyl)-24H-porphyrin-2-ylidene]methanol (PubChem CID 135665874) has the molecular formula C49H38N4O and a molecular weight of 698.87 g/mol. Its IUPAC name is (Z)-[5,10,15,20-tetrakis(4-methylphenyl)-24H-porphyrin-2-ylidene]methanol.
| Compound Name | (Z)-[5,10,15,20-tetrakis(4-methylphenyl)-24H-porphyrin-2-ylidene]methanol |
|---|---|
| PubChem CID | 135665874 |
| Molecular Formula | C49H38N4O |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | (Z)-[5,10,15,20-tetrakis(4-methylphenyl)-24H-porphyrin-2-ylidene]methanol |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C)cc3)C3=NC2=C/C3=C/O)cc1 |
| InChI | InChI=1S/C49H38N4O/c1-29-5-13-33(14-6-29)45-38-21-22-39(50-38)46(34-15-7-30(2)8-16-34)41-25-26-43(52-41)48(36-19-11-32(4)12-20-36)49-37(28-54)27-44(53-49)47(42-24-23-40(45)51-42)35-17-9-31(3)10-18-35/h5-28,52,54H,1-4H3/b37-28-,45-38-,46-41-,47-42-,48-43- |
| InChIKey | VJKUFCSCLFNXFZ-UZZSFHOLSA-N |
| XLogP | 9.28 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|