C48H26F12N4 — CID 136717375
5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-2,23-dihydroporphyrin (PubChem CID 136717375) has the molecular formula C48H26F12N4 and a molecular weight of 886.74 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-2,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-2,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136717375 |
| Molecular Formula | C48H26F12N4 |
| Molecular Weight | 886.74 g/mol |
| Exact Mass | 886.20 |
| IUPAC Name | 5,10,15,20-tetrakis[4-(trifluoromethyl)phenyl]-2,23-dihydroporphyrin |
| SMILES | FC(F)(F)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C(F)(F)F)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C(F)(F)F)cc3)C3=N/C(=C(/c4ccc(C(F)(F)F)cc4)C4=NC2=CC4)C=C3)cc1 |
| InChI | InChI=1S/C48H26F12N4/c49-45(50,51)29-9-1-25(2-10-29)41-33-17-19-35(61-33)42(26-3-11-30(12-4-26)46(52,53)54)37-21-23-39(63-37)44(28-7-15-32(16-8-28)48(58,59)60)40-24-22-38(64-40)43(36-20-18-34(41)62-36)27-5-13-31(14-6-27)47(55,56)57/h1-23,61H,24H2/b41-33-,42-35-,43-36-,44-39- |
| InChIKey | PMOLNMVJZJXJAJ-DLJQTLRXSA-N |
| XLogP | 12.07 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.74 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |