C48H34N4 — CID 149434413
10,12,14,15-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,11(27),12,14,16,18,20,22-dodecaene (PubChem CID 149434413) has the molecular formula C48H34N4 and a molecular weight of 666.83 g/mol. Its IUPAC name is 10,12,14,15-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,11(27),12,14,16,18,20,22-dodecaene.
| Compound Name | 10,12,14,15-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,11(27),12,14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 149434413 |
| Molecular Formula | C48H34N4 |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | 10,12,14,15-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,11(27),12,14,16,18,20,22-dodecaene |
| SMILES | C1=CC2=c3cc4[nH]c(c(-c5ccccc5)c5nc(cc6ccc(cc(n3)C2C=C1)[nH]6)=CC5c1ccccc1)c(-c1ccccc1)c4-c1ccccc1 |
| InChI | InChI=1S/C48H34N4/c1-5-15-31(16-6-1)40-28-37-27-35-25-26-36(49-35)29-41-38-23-13-14-24-39(38)42(51-41)30-43-44(32-17-7-2-8-18-32)45(33-19-9-3-10-20-33)48(52-43)46(47(40)50-37)34-21-11-4-12-22-34/h1-30,38,40,49,52H/b35-27-,36-29-,43-30-,48-46- |
| InChIKey | OAHAILJUHJJLFX-BHWKKBOPSA-N |
| XLogP | 9.99 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |