C50H16F20N4 — CID 137065851
5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2-phenyl-1,2,3,23-tetrahydroporphyrin (PubChem CID 137065851) has the molecular formula C50H16F20N4 and a molecular weight of 1052.67 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2-phenyl-1,2,3,23-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2-phenyl-1,2,3,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 137065851 |
| Molecular Formula | C50H16F20N4 |
| Molecular Weight | 1052.67 g/mol |
| Exact Mass | 1052.11 |
| IUPAC Name | 5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2-phenyl-1,2,3,23-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=C3C=CC(=N3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)C3=NC(=C(c4c(F)c(F)c(F)c(F)c4F)C4N=C2CC4c2ccccc2)C=C3)c(F)c1F |
| InChI | InChI=1S/C50H16F20N4/c51-30-26(31(52)39(60)46(67)38(30)59)22-15-6-7-16(71-15)23(27-32(53)40(61)47(68)41(62)33(27)54)18-10-11-20(73-18)25(29-36(57)44(65)49(70)45(66)37(29)58)50-14(13-4-2-1-3-5-13)12-21(74-50)24(19-9-8-17(22)72-19)28-34(55)42(63)48(69)43(64)35(28)56/h1-11,14,50,71H,12H2 |
| InChIKey | FJMASWNKQHOFJU-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1052.67 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|