C22H20ClN5OS — CID 135665908
N-[(E)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 135665908) has the molecular formula C22H20ClN5OS and a molecular weight of 437.96 g/mol. Its IUPAC name is N-[(E)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135665908 |
| Molecular Formula | C22H20ClN5OS |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[(E)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(/N=N/c2sc(N/N=C/C3=C(Cl)c4ccccc4CC3)nc2C)cc1 |
| InChI | InChI=1S/C22H20ClN5OS/c1-14-21(27-26-17-9-11-18(29-2)12-10-17)30-22(25-14)28-24-13-16-8-7-15-5-3-4-6-19(15)20(16)23/h3-6,9-13H,7-8H2,1-2H3,(H,25,28)/b24-13+,27-26+ |
| InChIKey | MXRYRRLEERUYRK-TUPHSRJVSA-N |
| XLogP | 6.87 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|