About [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate
[[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate (PubChem CID 135675067) has the molecular formula C16H18N3O2+
and a molecular weight of 284.34 g/mol. Its IUPAC name is [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate.
Molecular Properties
| Compound Name | [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate |
| PubChem CID | 135675067 |
| Molecular Formula | C16H18N3O2+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)ON=C(N)c1ccc[nH+]c1)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2/c1-2-14(12-7-4-3-5-8-12)16(20)21-19-15(17)13-9-6-10-18-11-13/h3-11,14H,2H2,1H3,(H2,17,19)/p+1/t14-/m1/s1 |
| InChIKey | SHXPXEIDJRRBBU-CQSZACIVSA-O |
| XLogP | 1.86 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate?
The IUPAC name of [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate (CID 135675067) is [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate.
What is the SMILES notation for [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate?
The canonical SMILES for [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate is CC[C@@H](C(=O)ON=C(N)c1ccc[nH+]c1)c1ccccc1.
What is the InChIKey of [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate?
The InChIKey is SHXPXEIDJRRBBU-CQSZACIVSA-O. The full InChI is InChI=1S/C16H17N3O2/c1-2-14(12-7-4-3-5-8-12)16(20)21-19-15(17)13-9-6-10-18-11-13/h3-11,14H,2H2,1H3,(H2,17,19)/p+1/t14-/m1/s1.
What are the key properties of [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate?
[[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate has a molecular weight of 284.34 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2R)-2-phenylbutanoate is sourced from PubChem (CID 135675067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).