C16H14ClN7O2 — CID 135678633
(2E)-N'-[1-[(4-chlorophenyl)methyl]tetrazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide (PubChem CID 135678633) has the molecular formula C16H14ClN7O2 and a molecular weight of 371.79 g/mol. Its IUPAC name is (2E)-N'-[1-[(4-chlorophenyl)methyl]tetrazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide.
| Compound Name | (2E)-N'-[1-[(4-chlorophenyl)methyl]tetrazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
|---|---|
| PubChem CID | 135678633 |
| Molecular Formula | C16H14ClN7O2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (2E)-N'-[1-[(4-chlorophenyl)methyl]tetrazol-5-yl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
| SMILES | O/N=C(C(=N/c1nnnn1Cc1ccc(Cl)cc1)/NO)\c1ccccc1 |
| InChI | InChI=1S/C16H14ClN7O2/c17-13-8-6-11(7-9-13)10-24-16(19-22-23-24)18-15(21-26)14(20-25)12-4-2-1-3-5-12/h1-9,25-26H,10H2,(H,18,19,21,23)/b20-14+ |
| InChIKey | WDRFQYBTMLQZTE-XSFVSMFZSA-N |
| XLogP | 2.26 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|