C14H11N5O3 — CID 135839474
(2E)-N-hydroxy-2-hydroxyimino-N'-([1,2]oxazolo[5,4-b]pyridin-3-yl)-2-phenylethanimidamide (PubChem CID 135839474) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is (2E)-N-hydroxy-2-hydroxyimino-N'-([1,2]oxazolo[5,4-b]pyridin-3-yl)-2-phenylethanimidamide.
| Compound Name | (2E)-N-hydroxy-2-hydroxyimino-N'-([1,2]oxazolo[5,4-b]pyridin-3-yl)-2-phenylethanimidamide |
|---|---|
| PubChem CID | 135839474 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (2E)-N-hydroxy-2-hydroxyimino-N'-([1,2]oxazolo[5,4-b]pyridin-3-yl)-2-phenylethanimidamide |
| SMILES | O/N=C(C(=N/c1noc2ncccc12)/NO)\c1ccccc1 |
| InChI | InChI=1S/C14H11N5O3/c20-17-11(9-5-2-1-3-6-9)13(18-21)16-12-10-7-4-8-15-14(10)22-19-12/h1-8,20-21H,(H,16,18,19)/b17-11+ |
| InChIKey | DIPUTAVEXSYDPC-GZTJUZNOSA-N |
| XLogP | 2.11 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|