C19H23N5O4S — CID 135680570
6-[(3,4-dimethoxyphenyl)methyl]-3-(3,3-dimethyl-2-oxobutyl)sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one (PubChem CID 135680570) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 6-[(3,4-dimethoxyphenyl)methyl]-3-(3,3-dimethyl-2-oxobutyl)sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one.
| Compound Name | 6-[(3,4-dimethoxyphenyl)methyl]-3-(3,3-dimethyl-2-oxobutyl)sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 135680570 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 6-[(3,4-dimethoxyphenyl)methyl]-3-(3,3-dimethyl-2-oxobutyl)sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| SMILES | COc1ccc(Cc2nn3c(SCC(=O)C(C)(C)C)nnc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C19H23N5O4S/c1-19(2,3)15(25)10-29-18-22-21-17-20-16(26)12(23-24(17)18)8-11-6-7-13(27-4)14(9-11)28-5/h6-7,9H,8,10H2,1-5H3,(H,20,21,26) |
| InChIKey | QHWBVDAFCDWIFA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |