C29H23N5O5 — CID 135682580
[(2S)-3-(6-benzoylimino-7H-purin-3-yl)-2-benzoyloxypropyl] benzoate (PubChem CID 135682580) has the molecular formula C29H23N5O5 and a molecular weight of 521.53 g/mol. Its IUPAC name is [(2S)-3-(6-benzoylimino-7H-purin-3-yl)-2-benzoyloxypropyl] benzoate.
| Compound Name | [(2S)-3-(6-benzoylimino-7H-purin-3-yl)-2-benzoyloxypropyl] benzoate |
|---|---|
| PubChem CID | 135682580 |
| Molecular Formula | C29H23N5O5 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [(2S)-3-(6-benzoylimino-7H-purin-3-yl)-2-benzoyloxypropyl] benzoate |
| SMILES | O=C(/N=c1\ncn(C[C@@H](COC(=O)c2ccccc2)OC(=O)c2ccccc2)c2nc[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C29H23N5O5/c35-27(20-10-4-1-5-11-20)33-25-24-26(31-18-30-24)34(19-32-25)16-23(39-29(37)22-14-8-3-9-15-22)17-38-28(36)21-12-6-2-7-13-21/h1-15,18-19,23H,16-17H2,(H,30,31)/b33-25-/t23-/m0/s1 |
| InChIKey | IVYDYLZTTZNOHG-QQJIGTMBSA-N |
| XLogP | 3.58 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |