C20H17ClN2O4S — CID 135690830
2-chloro-5-[(2-hydroxyphenyl)methylideneamino]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 135690830) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is 2-chloro-5-[(2-hydroxyphenyl)methylideneamino]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-[(2-hydroxyphenyl)methylideneamino]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 135690830 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-chloro-5-[(2-hydroxyphenyl)methylideneamino]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(/N=C/c2ccccc2O)ccc1Cl |
| InChI | InChI=1S/C20H17ClN2O4S/c1-27-19-9-5-3-7-17(19)23-28(25,26)20-12-15(10-11-16(20)21)22-13-14-6-2-4-8-18(14)24/h2-13,23-24H,1H3/b22-13+ |
| InChIKey | NGIODHIJEYFKEE-LPYMAVHISA-N |
| XLogP | 4.61 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|