C25H24N6O6 — CID 135693166
ethyl 3-[[2-[(4-ethoxycarbonylphenyl)diazenyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-imidazol-4-yl]diazenyl]benzoate (PubChem CID 135693166) has the molecular formula C25H24N6O6 and a molecular weight of 504.50 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-ethoxycarbonylphenyl)diazenyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-imidazol-4-yl]diazenyl]benzoate.
| Compound Name | ethyl 3-[[2-[(4-ethoxycarbonylphenyl)diazenyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-imidazol-4-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 135693166 |
| Molecular Formula | C25H24N6O6 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | ethyl 3-[[2-[(4-ethoxycarbonylphenyl)diazenyl]-5-[(E)-3-methoxy-3-oxoprop-1-enyl]-1H-imidazol-4-yl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/c2nc(/N=N/c3cccc(C(=O)OCC)c3)c(/C=C/C(=O)OC)[nH]2)cc1 |
| InChI | InChI=1S/C25H24N6O6/c1-4-36-23(33)16-9-11-18(12-10-16)28-31-25-26-20(13-14-21(32)35-3)22(27-25)30-29-19-8-6-7-17(15-19)24(34)37-5-2/h6-15H,4-5H2,1-3H3,(H,26,27)/b14-13+,30-29+,31-28+ |
| InChIKey | DCIBMPKEVARZTJ-QNAFWFSXSA-N |
| XLogP | 5.78 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|